C15H19N3O4 — CID 82224224
1-[3-(4-ethoxyphenoxy)propyl]-5-methyltriazole-4-carboxylic acid (PubChem CID 82224224) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-[3-(4-ethoxyphenoxy)propyl]-5-methyltriazole-4-carboxylic acid.
| Compound Name | 1-[3-(4-ethoxyphenoxy)propyl]-5-methyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82224224 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[3-(4-ethoxyphenoxy)propyl]-5-methyltriazole-4-carboxylic acid |
| SMILES | CCOc1ccc(OCCCn2nnc(C(=O)O)c2C)cc1 |
| InChI | InChI=1S/C15H19N3O4/c1-3-21-12-5-7-13(8-6-12)22-10-4-9-18-11(2)14(15(19)20)16-17-18/h5-8H,3-4,9-10H2,1-2H3,(H,19,20) |
| InChIKey | CRDLEQPIHSNQGO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|