C16H21N3O4 — CID 94945234
3-[1-[3-(4-methoxyphenoxy)propyl]-5-methyltriazol-4-yl]propanoic acid (PubChem CID 94945234) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-[1-[3-(4-methoxyphenoxy)propyl]-5-methyltriazol-4-yl]propanoic acid.
| Compound Name | 3-[1-[3-(4-methoxyphenoxy)propyl]-5-methyltriazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 94945234 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 3-[1-[3-(4-methoxyphenoxy)propyl]-5-methyltriazol-4-yl]propanoic acid |
| SMILES | COc1ccc(OCCCn2nnc(CCC(=O)O)c2C)cc1 |
| InChI | InChI=1S/C16H21N3O4/c1-12-15(8-9-16(20)21)17-18-19(12)10-3-11-23-14-6-4-13(22-2)5-7-14/h4-7H,3,8-11H2,1-2H3,(H,20,21) |
| InChIKey | RSXQTHTYWKBJGK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|