C12H4F3N5S — CID 94962586
1-(1,3-thiazol-2-yl)-5-(2,3,4-trifluorophenyl)triazole-4-carbonitrile (PubChem CID 94962586) has the molecular formula C12H4F3N5S and a molecular weight of 307.26 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)-5-(2,3,4-trifluorophenyl)triazole-4-carbonitrile.
| Compound Name | 1-(1,3-thiazol-2-yl)-5-(2,3,4-trifluorophenyl)triazole-4-carbonitrile |
|---|---|
| PubChem CID | 94962586 |
| Molecular Formula | C12H4F3N5S |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)-5-(2,3,4-trifluorophenyl)triazole-4-carbonitrile |
| SMILES | N#Cc1nnn(-c2nccs2)c1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H4F3N5S/c13-7-2-1-6(9(14)10(7)15)11-8(5-16)18-19-20(11)12-17-3-4-21-12/h1-4H |
| InChIKey | QSHRQBAZCPENFK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|