C18H20N2O3S — CID 94975517
1-[(2R,6R)-2-methyl-6-phenylmorpholin-4-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone (PubChem CID 94975517) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-[(2R,6R)-2-methyl-6-phenylmorpholin-4-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone.
| Compound Name | 1-[(2R,6R)-2-methyl-6-phenylmorpholin-4-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 94975517 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[(2R,6R)-2-methyl-6-phenylmorpholin-4-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone |
| SMILES | C[C@@H]1CN(C(=O)CSc2cccc[n+]2[O-])C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C18H20N2O3S/c1-14-11-19(12-16(23-14)15-7-3-2-4-8-15)17(21)13-24-18-9-5-6-10-20(18)22/h2-10,14,16H,11-13H2,1H3/t14-,16+/m1/s1 |
| InChIKey | BZLYDVYJIBHNHF-ZBFHGGJFSA-N |
| XLogP | 2.40 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|