C18H23N3O4 — CID 95772464
5,5-dimethyl-1-[2-[(2R,6S)-2-methyl-6-phenylmorpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 95772464) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5,5-dimethyl-1-[2-[(2R,6S)-2-methyl-6-phenylmorpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1-[2-[(2R,6S)-2-methyl-6-phenylmorpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95772464 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 5,5-dimethyl-1-[2-[(2R,6S)-2-methyl-6-phenylmorpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H]1CN(C(=O)CN2C(=O)NC(=O)C2(C)C)C[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C18H23N3O4/c1-12-9-20(10-14(25-12)13-7-5-4-6-8-13)15(22)11-21-17(24)19-16(23)18(21,2)3/h4-8,12,14H,9-11H2,1-3H3,(H,19,23,24)/t12-,14-/m1/s1 |
| InChIKey | QSOHOQUSBPYBFT-TZMCWYRMSA-N |
| XLogP | 1.31 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|