C17H20ClN3O4 — CID 56862525
1-[2-[2-(4-chlorophenyl)morpholin-4-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 56862525) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is 1-[2-[2-(4-chlorophenyl)morpholin-4-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[2-[2-(4-chlorophenyl)morpholin-4-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56862525 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-[2-[2-(4-chlorophenyl)morpholin-4-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)NC(=O)N1CC(=O)N1CCOC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H20ClN3O4/c1-17(2)15(23)19-16(24)21(17)10-14(22)20-7-8-25-13(9-20)11-3-5-12(18)6-4-11/h3-6,13H,7-10H2,1-2H3,(H,19,23,24) |
| InChIKey | AZGWXJAOFVCDEZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|