About (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine
(2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine (PubChem CID 94982663) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine |
| PubChem CID | 94982663 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine |
| SMILES | CC(C)[C@H]1CNC(C)(C)CN1C |
| InChI | InChI=1S/C10H22N2/c1-8(2)9-6-11-10(3,4)7-12(9)5/h8-9,11H,6-7H2,1-5H3/t9-/m1/s1 |
| InChIKey | XMYGZEPMSDOZBB-SECBINFHSA-N |
| XLogP | 1.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine?
The IUPAC name of (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine (CID 94982663) is (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine.
What is the SMILES notation for (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine?
The canonical SMILES for (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine is CC(C)[C@H]1CNC(C)(C)CN1C.
What is the InChIKey of (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine?
The InChIKey is XMYGZEPMSDOZBB-SECBINFHSA-N. The full InChI is InChI=1S/C10H22N2/c1-8(2)9-6-11-10(3,4)7-12(9)5/h8-9,11H,6-7H2,1-5H3/t9-/m1/s1.
What are the key properties of (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine?
(2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine has a molecular weight of 170.30 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,5,5-trimethyl-2-propan-2-ylpiperazine is sourced from PubChem (CID 94982663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).