C25H22 — CID 9498786
(3R,4S,5S,6S)-4-methyl-5,6-diphenyltetracyclo[6.4.0.03,5.03,6]dodeca-1(12),8,10-triene (PubChem CID 9498786) has the molecular formula C25H22 and a molecular weight of 322.45 g/mol. Its IUPAC name is (3R,4S,5S,6S)-4-methyl-5,6-diphenyltetracyclo[6.4.0.03,5.03,6]dodeca-1(12),8,10-triene.
| Compound Name | (3R,4S,5S,6S)-4-methyl-5,6-diphenyltetracyclo[6.4.0.03,5.03,6]dodeca-1(12),8,10-triene |
|---|---|
| PubChem CID | 9498786 |
| Molecular Formula | C25H22 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (3R,4S,5S,6S)-4-methyl-5,6-diphenyltetracyclo[6.4.0.03,5.03,6]dodeca-1(12),8,10-triene |
| SMILES | C[C@H]1[C@]23Cc4ccccc4C[C@@]2(c2ccccc2)[C@]13c1ccccc1 |
| InChI | InChI=1S/C25H22/c1-18-23-16-19-10-8-9-11-20(19)17-24(23,21-12-4-2-5-13-21)25(18,23)22-14-6-3-7-15-22/h2-15,18H,16-17H2,1H3/t18-,23+,24-,25-/m0/s1 |
| InChIKey | RRUJBCZFHHSRHB-PVUOONDNSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |