C31H35N3O4 — CID 95025626
(2E)-2-[[4-(diethylamino)phenyl]methylidene]-6-hydroxy-7-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1-benzofuran-3-one (PubChem CID 95025626) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is (2E)-2-[[4-(diethylamino)phenyl]methylidene]-6-hydroxy-7-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1-benzofuran-3-one.
| Compound Name | (2E)-2-[[4-(diethylamino)phenyl]methylidene]-6-hydroxy-7-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95025626 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | (2E)-2-[[4-(diethylamino)phenyl]methylidene]-6-hydroxy-7-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1-benzofuran-3-one |
| SMILES | CCN(CC)c1ccc(/C=C2/Oc3c(ccc(O)c3CN3CCN(c4ccc(OC)cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C31H35N3O4/c1-4-33(5-2)23-8-6-22(7-9-23)20-29-30(36)26-14-15-28(35)27(31(26)38-29)21-32-16-18-34(19-17-32)24-10-12-25(37-3)13-11-24/h6-15,20,35H,4-5,16-19,21H2,1-3H3/b29-20+ |
| InChIKey | HIQQMZVEDYTVDX-ZTKZIYFRSA-N |
| XLogP | 5.19 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|