C29H28Cl2N2O3 — CID 95025647
(7Z)-3-[(3,4-dichlorophenyl)methyl]-7-[[4-(diethylamino)phenyl]methylidene]-9-methyl-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one (PubChem CID 95025647) has the molecular formula C29H28Cl2N2O3 and a molecular weight of 523.46 g/mol. Its IUPAC name is (7Z)-3-[(3,4-dichlorophenyl)methyl]-7-[[4-(diethylamino)phenyl]methylidene]-9-methyl-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one.
| Compound Name | (7Z)-3-[(3,4-dichlorophenyl)methyl]-7-[[4-(diethylamino)phenyl]methylidene]-9-methyl-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one |
|---|---|
| PubChem CID | 95025647 |
| Molecular Formula | C29H28Cl2N2O3 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | (7Z)-3-[(3,4-dichlorophenyl)methyl]-7-[[4-(diethylamino)phenyl]methylidene]-9-methyl-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3c(cc4c(c3C)OCN(Cc3ccc(Cl)c(Cl)c3)C4)C2=O)cc1 |
| InChI | InChI=1S/C29H28Cl2N2O3/c1-4-33(5-2)22-9-6-19(7-10-22)13-26-27(34)23-14-21-16-32(15-20-8-11-24(30)25(31)12-20)17-35-28(21)18(3)29(23)36-26/h6-14H,4-5,15-17H2,1-3H3/b26-13- |
| InChIKey | AIRMCDHVXAYURE-ZMFRSBBQSA-N |
| XLogP | 7.12 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|