C30H30N2O5 — CID 95026612
(2Z)-8-(1,3-benzodioxol-5-ylmethyl)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one (PubChem CID 95026612) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is (2Z)-8-(1,3-benzodioxol-5-ylmethyl)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one.
| Compound Name | (2Z)-8-(1,3-benzodioxol-5-ylmethyl)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
|---|---|
| PubChem CID | 95026612 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (2Z)-8-(1,3-benzodioxol-5-ylmethyl)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3c4c(cc(C)c3C2=O)OCN(Cc2ccc3c(c2)OCO3)C4)cc1 |
| InChI | InChI=1S/C30H30N2O5/c1-4-32(5-2)22-9-6-20(7-10-22)13-27-29(33)28-19(3)12-25-23(30(28)37-27)16-31(17-34-25)15-21-8-11-24-26(14-21)36-18-35-24/h6-14H,4-5,15-18H2,1-3H3/b27-13- |
| InChIKey | RSXXKTHPHJYPFM-WKIKZPBSSA-N |
| XLogP | 5.54 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|