C29H26Cl2N2O5 — CID 95399254
(2Z)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-[(2,4-dichlorophenyl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one (PubChem CID 95399254) has the molecular formula C29H26Cl2N2O5 and a molecular weight of 553.44 g/mol. Its IUPAC name is (2Z)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-[(2,4-dichlorophenyl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-[(2,4-dichlorophenyl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95399254 |
| Molecular Formula | C29H26Cl2N2O5 |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | (2Z)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-[(2,4-dichlorophenyl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one |
| SMILES | Cc1cc(O)c(CN2CCN(Cc3ccc4c(c3)OCO4)CC2)c2c1C(=O)/C(=C/c1ccc(Cl)cc1Cl)O2 |
| InChI | InChI=1S/C29H26Cl2N2O5/c1-17-10-23(34)21(29-27(17)28(35)26(38-29)12-19-3-4-20(30)13-22(19)31)15-33-8-6-32(7-9-33)14-18-2-5-24-25(11-18)37-16-36-24/h2-5,10-13,34H,6-9,14-16H2,1H3/b26-12- |
| InChIKey | BXWYGRLJJTVKSL-ZRGSRPPYSA-N |
| XLogP | 5.67 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|