C30H31NO3 — CID 110275625
(2E)-7-[(3,5-dimethylpiperidin-1-yl)methyl]-6-hydroxy-4-methyl-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 110275625) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is (2E)-7-[(3,5-dimethylpiperidin-1-yl)methyl]-6-hydroxy-4-methyl-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2E)-7-[(3,5-dimethylpiperidin-1-yl)methyl]-6-hydroxy-4-methyl-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 110275625 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (2E)-7-[(3,5-dimethylpiperidin-1-yl)methyl]-6-hydroxy-4-methyl-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1cc(O)c(CN2CC(C)CC(C)C2)c2c1C(=O)/C(=C\c1ccc(-c3ccccc3)cc1)O2 |
| InChI | InChI=1S/C30H31NO3/c1-19-13-20(2)17-31(16-19)18-25-26(32)14-21(3)28-29(33)27(34-30(25)28)15-22-9-11-24(12-10-22)23-7-5-4-6-8-23/h4-12,14-15,19-20,32H,13,16-18H2,1-3H3/b27-15+ |
| InChIKey | LCYLLEYSKKVHCS-JFLMPSFJSA-N |
| XLogP | 6.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|