C31H32N2O7 — CID 95399193
(1S,9R)-11-[[(2Z)-6-hydroxy-4-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-7-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 95399193) has the molecular formula C31H32N2O7 and a molecular weight of 544.60 g/mol. Its IUPAC name is (1S,9R)-11-[[(2Z)-6-hydroxy-4-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-7-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9R)-11-[[(2Z)-6-hydroxy-4-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-7-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 95399193 |
| Molecular Formula | C31H32N2O7 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | (1S,9R)-11-[[(2Z)-6-hydroxy-4-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-7-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1\Oc2c(CN3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)c(O)cc(C)c2C1=O |
| InChI | InChI=1S/C31H32N2O7/c1-17-8-23(34)21(16-32-13-18-9-20(15-32)22-6-5-7-28(35)33(22)14-18)31-29(17)30(36)27(40-31)11-19-10-25(38-3)26(39-4)12-24(19)37-2/h5-8,10-12,18,20,34H,9,13-16H2,1-4H3/b27-11-/t18-,20+/m1/s1 |
| InChIKey | FFHXEVJOHHFJNW-SGYGFYBISA-N |
| XLogP | 4.12 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|