C26H28BrNO6 — CID 95399524
ethyl 1-[[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-hydroxy-4-methyl-3-oxo-1-benzofuran-7-yl]methyl]piperidine-4-carboxylate (PubChem CID 95399524) has the molecular formula C26H28BrNO6 and a molecular weight of 530.42 g/mol. Its IUPAC name is ethyl 1-[[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-hydroxy-4-methyl-3-oxo-1-benzofuran-7-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-hydroxy-4-methyl-3-oxo-1-benzofuran-7-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 95399524 |
| Molecular Formula | C26H28BrNO6 |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | ethyl 1-[[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-hydroxy-4-methyl-3-oxo-1-benzofuran-7-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2c(O)cc(C)c3c2O/C(=C/c2cc(Br)ccc2OC)C3=O)CC1 |
| InChI | InChI=1S/C26H28BrNO6/c1-4-33-26(31)16-7-9-28(10-8-16)14-19-20(29)11-15(2)23-24(30)22(34-25(19)23)13-17-12-18(27)5-6-21(17)32-3/h5-6,11-13,16,29H,4,7-10,14H2,1-3H3/b22-13+ |
| InChIKey | PVVODUHGWPECBD-LPYMAVHISA-N |
| XLogP | 4.86 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|