C27H31NO8 — CID 78149474
7-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-hydroxy-4-methyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 78149474) has the molecular formula C27H31NO8 and a molecular weight of 497.54 g/mol. Its IUPAC name is 7-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-hydroxy-4-methyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 7-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-hydroxy-4-methyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 78149474 |
| Molecular Formula | C27H31NO8 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 7-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-hydroxy-4-methyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1cc(C=C2Oc3c(CN4CCC5(CC4)OCCO5)c(O)cc(C)c3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H31NO8/c1-16-11-19(29)18(15-28-7-5-27(6-8-28)34-9-10-35-27)25-23(16)24(30)20(36-25)12-17-13-21(31-2)26(33-4)22(14-17)32-3/h11-14,29H,5-10,15H2,1-4H3 |
| InChIKey | RAWNRPFIIWKOEP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|