C30H28N2O7 — CID 95399271
(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-6-hydroxy-4-methyl-1-benzofuran-3-one (PubChem CID 95399271) has the molecular formula C30H28N2O7 and a molecular weight of 528.56 g/mol. Its IUPAC name is (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-6-hydroxy-4-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-6-hydroxy-4-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95399271 |
| Molecular Formula | C30H28N2O7 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-6-hydroxy-4-methyl-1-benzofuran-3-one |
| SMILES | Cc1cc(O)c(CN2CCN(Cc3ccc4c(c3)OCO4)CC2)c2c1C(=O)/C(=C/c1ccc3c(c1)OCO3)O2 |
| InChI | InChI=1S/C30H28N2O7/c1-18-10-22(33)21(15-32-8-6-31(7-9-32)14-20-3-5-24-26(13-20)38-17-36-24)30-28(18)29(34)27(39-30)12-19-2-4-23-25(11-19)37-16-35-23/h2-5,10-13,33H,6-9,14-17H2,1H3/b27-12- |
| InChIKey | WBHVSFCXXCFOJP-PPDIBHTLSA-N |
| XLogP | 4.09 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|