C33H33N3O5 — CID 95399275
(2E)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-[(1-ethylindol-3-yl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one (PubChem CID 95399275) has the molecular formula C33H33N3O5 and a molecular weight of 551.64 g/mol. Its IUPAC name is (2E)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-[(1-ethylindol-3-yl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one.
| Compound Name | (2E)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-[(1-ethylindol-3-yl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95399275 |
| Molecular Formula | C33H33N3O5 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | (2E)-7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-[(1-ethylindol-3-yl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one |
| SMILES | CCn1cc(/C=C2/Oc3c(CN4CCN(Cc5ccc6c(c5)OCO6)CC4)c(O)cc(C)c3C2=O)c2ccccc21 |
| InChI | InChI=1S/C33H33N3O5/c1-3-36-18-23(24-6-4-5-7-26(24)36)16-30-32(38)31-21(2)14-27(37)25(33(31)41-30)19-35-12-10-34(11-13-35)17-22-8-9-28-29(15-22)40-20-39-28/h4-9,14-16,18,37H,3,10-13,17,19-20H2,1-2H3/b30-16+ |
| InChIKey | ZUOMLDVHJXRZFP-OKCVXOCRSA-N |
| XLogP | 5.34 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|