C30H27ClN2O6 — CID 95399202
(1R,9S)-11-[[(2E)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-6-hydroxy-4-methyl-3-oxo-1-benzofuran-7-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 95399202) has the molecular formula C30H27ClN2O6 and a molecular weight of 547.01 g/mol. Its IUPAC name is (1R,9S)-11-[[(2E)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-6-hydroxy-4-methyl-3-oxo-1-benzofuran-7-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-[[(2E)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-6-hydroxy-4-methyl-3-oxo-1-benzofuran-7-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 95399202 |
| Molecular Formula | C30H27ClN2O6 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | (1R,9S)-11-[[(2E)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylidene]-6-hydroxy-4-methyl-3-oxo-1-benzofuran-7-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1cc(O)c(CN2C[C@@H]3C[C@H](C2)c2cccc(=O)n2C3)c2c1C(=O)/C(=C\c1cc(Cl)cc3c1OCOC3)O2 |
| InChI | InChI=1S/C30H27ClN2O6/c1-16-5-24(34)22(13-32-10-17-6-19(12-32)23-3-2-4-26(35)33(23)11-17)30-27(16)28(36)25(39-30)9-18-7-21(31)8-20-14-37-15-38-29(18)20/h2-5,7-9,17,19,34H,6,10-15H2,1H3/b25-9+/t17-,19+/m0/s1 |
| InChIKey | GAXNVRKTKKCYGY-QNDBYKNOSA-N |
| XLogP | 4.62 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|