C25H28BrNO7 — CID 95399173
(2E)-7-[[bis(2-methoxyethyl)amino]methyl]-2-[(6-bromo-4H-1,3-benzodioxin-8-yl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one (PubChem CID 95399173) has the molecular formula C25H28BrNO7 and a molecular weight of 534.40 g/mol. Its IUPAC name is (2E)-7-[[bis(2-methoxyethyl)amino]methyl]-2-[(6-bromo-4H-1,3-benzodioxin-8-yl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one.
| Compound Name | (2E)-7-[[bis(2-methoxyethyl)amino]methyl]-2-[(6-bromo-4H-1,3-benzodioxin-8-yl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95399173 |
| Molecular Formula | C25H28BrNO7 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | (2E)-7-[[bis(2-methoxyethyl)amino]methyl]-2-[(6-bromo-4H-1,3-benzodioxin-8-yl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one |
| SMILES | COCCN(CCOC)Cc1c(O)cc(C)c2c1O/C(=C/c1cc(Br)cc3c1OCOC3)C2=O |
| InChI | InChI=1S/C25H28BrNO7/c1-15-8-20(28)19(12-27(4-6-30-2)5-7-31-3)25-22(15)23(29)21(34-25)11-16-9-18(26)10-17-13-32-14-33-24(16)17/h8-11,28H,4-7,12-14H2,1-3H3/b21-11+ |
| InChIKey | NPXIBHZZQGVCNN-SRZZPIQSSA-N |
| XLogP | 4.04 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|