C30H31NO8 — CID 95399719
(2Z)-8-[(3,4-dimethoxyphenyl)methyl]-4-methyl-2-[(2,3,4-trimethoxyphenyl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one (PubChem CID 95399719) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is (2Z)-8-[(3,4-dimethoxyphenyl)methyl]-4-methyl-2-[(2,3,4-trimethoxyphenyl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one.
| Compound Name | (2Z)-8-[(3,4-dimethoxyphenyl)methyl]-4-methyl-2-[(2,3,4-trimethoxyphenyl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
|---|---|
| PubChem CID | 95399719 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | (2Z)-8-[(3,4-dimethoxyphenyl)methyl]-4-methyl-2-[(2,3,4-trimethoxyphenyl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
| SMILES | COc1ccc(CN2COc3cc(C)c4c(c3C2)O/C(=C\c2ccc(OC)c(OC)c2OC)C4=O)cc1OC |
| InChI | InChI=1S/C30H31NO8/c1-17-11-23-20(15-31(16-38-23)14-18-7-9-21(33-2)24(12-18)35-4)29-26(17)27(32)25(39-29)13-19-8-10-22(34-3)30(37-6)28(19)36-5/h7-13H,14-16H2,1-6H3/b25-13- |
| InChIKey | QBDXPDWVYGFFRQ-MXAYSNPKSA-N |
| XLogP | 5.01 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|