C30H30Cl2N2O3 — CID 95399773
(2E)-8-[2-(2,4-dichlorophenyl)ethyl]-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one (PubChem CID 95399773) has the molecular formula C30H30Cl2N2O3 and a molecular weight of 537.49 g/mol. Its IUPAC name is (2E)-8-[2-(2,4-dichlorophenyl)ethyl]-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one.
| Compound Name | (2E)-8-[2-(2,4-dichlorophenyl)ethyl]-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
|---|---|
| PubChem CID | 95399773 |
| Molecular Formula | C30H30Cl2N2O3 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | (2E)-8-[2-(2,4-dichlorophenyl)ethyl]-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
| SMILES | CCN(CC)c1ccc(/C=C2/Oc3c4c(cc(C)c3C2=O)OCN(CCc2ccc(Cl)cc2Cl)C4)cc1 |
| InChI | InChI=1S/C30H30Cl2N2O3/c1-4-34(5-2)23-10-6-20(7-11-23)15-27-29(35)28-19(3)14-26-24(30(28)37-27)17-33(18-36-26)13-12-21-8-9-22(31)16-25(21)32/h6-11,14-16H,4-5,12-13,17-18H2,1-3H3/b27-15+ |
| InChIKey | JEKPMLBGUBSZCQ-JFLMPSFJSA-N |
| XLogP | 7.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|