C17H18N4O3 — CID 950365
5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-(4-nitrophenyl)-1,3-oxazole-4-carbonitrile (PubChem CID 950365) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-(4-nitrophenyl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-(4-nitrophenyl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 950365 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-(4-nitrophenyl)-1,3-oxazole-4-carbonitrile |
| SMILES | C[C@H]1C[C@H](C)CN(c2oc(-c3ccc([N+](=O)[O-])cc3)nc2C#N)C1 |
| InChI | InChI=1S/C17H18N4O3/c1-11-7-12(2)10-20(9-11)17-15(8-18)19-16(24-17)13-3-5-14(6-4-13)21(22)23/h3-6,11-12H,7,9-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | YLDULFYBKSPFSD-RYUDHWBXSA-N |
| XLogP | 3.60 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|