C16H16N4O4 — CID 3774642
5-(2,6-dimethylmorpholin-4-yl)-2-(2-nitrophenyl)-1,3-oxazole-4-carbonitrile (PubChem CID 3774642) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 5-(2,6-dimethylmorpholin-4-yl)-2-(2-nitrophenyl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-(2,6-dimethylmorpholin-4-yl)-2-(2-nitrophenyl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 3774642 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 5-(2,6-dimethylmorpholin-4-yl)-2-(2-nitrophenyl)-1,3-oxazole-4-carbonitrile |
| SMILES | CC1CN(c2oc(-c3ccccc3[N+](=O)[O-])nc2C#N)CC(C)O1 |
| InChI | InChI=1S/C16H16N4O4/c1-10-8-19(9-11(2)23-10)16-13(7-17)18-15(24-16)12-5-3-4-6-14(12)20(21)22/h3-6,10-11H,8-9H2,1-2H3 |
| InChIKey | GPNVIQMCLXPKSR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|