C23H23N3O8S — CID 16650559
4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-(2-nitrophenyl)-1,3-oxazol-5-yl]-2,6-dimethylmorpholine (PubChem CID 16650559) has the molecular formula C23H23N3O8S and a molecular weight of 501.52 g/mol. Its IUPAC name is 4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-(2-nitrophenyl)-1,3-oxazol-5-yl]-2,6-dimethylmorpholine.
| Compound Name | 4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-(2-nitrophenyl)-1,3-oxazol-5-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 16650559 |
| Molecular Formula | C23H23N3O8S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-(2-nitrophenyl)-1,3-oxazol-5-yl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2oc(-c3ccccc3[N+](=O)[O-])nc2S(=O)(=O)c2ccc3c(c2)OCCO3)CC(C)O1 |
| InChI | InChI=1S/C23H23N3O8S/c1-14-12-25(13-15(2)33-14)23-22(24-21(34-23)17-5-3-4-6-18(17)26(27)28)35(29,30)16-7-8-19-20(11-16)32-10-9-31-19/h3-8,11,14-15H,9-10,12-13H2,1-2H3 |
| InChIKey | SLKRAUMDPVADMM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 134.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|