C21H19N3O8S — CID 16650558
4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-(2-nitrophenyl)-1,3-oxazol-5-yl]morpholine (PubChem CID 16650558) has the molecular formula C21H19N3O8S and a molecular weight of 473.46 g/mol. Its IUPAC name is 4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-(2-nitrophenyl)-1,3-oxazol-5-yl]morpholine.
| Compound Name | 4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-(2-nitrophenyl)-1,3-oxazol-5-yl]morpholine |
|---|---|
| PubChem CID | 16650558 |
| Molecular Formula | C21H19N3O8S |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-(2-nitrophenyl)-1,3-oxazol-5-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc(S(=O)(=O)c2ccc3c(c2)OCCO3)c(N2CCOCC2)o1 |
| InChI | InChI=1S/C21H19N3O8S/c25-24(26)16-4-2-1-3-15(16)19-22-20(21(32-19)23-7-9-29-10-8-23)33(27,28)14-5-6-17-18(13-14)31-12-11-30-17/h1-6,13H,7-12H2 |
| InChIKey | FGEMUEFIYWFAJX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 134.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|