C20H20N2OS — CID 95045417
3-[(1S)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 95045417) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 3-[(1S)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[(1S)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 95045417 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 3-[(1S)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CC1(C)CC[C@H](n2c(=S)[nH]c3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C20H20N2OS/c1-20(2)12-11-17(13-7-3-5-9-15(13)20)22-18(23)14-8-4-6-10-16(14)21-19(22)24/h3-10,17H,11-12H2,1-2H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | DWCYLIDGTOSMRN-KRWDZBQOSA-N |
| XLogP | 4.72 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|