C17H18N2O2S — CID 99605129
3-[(1S,5R,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 99605129) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-[(1S,5R,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[(1S,5R,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 99605129 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[(1S,5R,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1[C@@H]1[C@H]2CCO[C@@H]2C12CCC2 |
| InChI | InChI=1S/C17H18N2O2S/c20-15-10-4-1-2-5-12(10)18-16(22)19(15)13-11-6-9-21-14(11)17(13)7-3-8-17/h1-2,4-5,11,13-14H,3,6-9H2,(H,18,22)/t11-,13-,14+/m1/s1 |
| InChIKey | HVQGCHSMDJJGAI-BNOWGMLFSA-N |
| XLogP | 3.19 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|