C16H20F2N2O4S — CID 95047272
2-[(1R)-1-(2,6-difluorophenyl)ethyl]sulfonyl-N-[(3S)-2-oxoazepan-3-yl]acetamide (PubChem CID 95047272) has the molecular formula C16H20F2N2O4S and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-[(1R)-1-(2,6-difluorophenyl)ethyl]sulfonyl-N-[(3S)-2-oxoazepan-3-yl]acetamide.
| Compound Name | 2-[(1R)-1-(2,6-difluorophenyl)ethyl]sulfonyl-N-[(3S)-2-oxoazepan-3-yl]acetamide |
|---|---|
| PubChem CID | 95047272 |
| Molecular Formula | C16H20F2N2O4S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[(1R)-1-(2,6-difluorophenyl)ethyl]sulfonyl-N-[(3S)-2-oxoazepan-3-yl]acetamide |
| SMILES | C[C@H](c1c(F)cccc1F)S(=O)(=O)CC(=O)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C16H20F2N2O4S/c1-10(15-11(17)5-4-6-12(15)18)25(23,24)9-14(21)20-13-7-2-3-8-19-16(13)22/h4-6,10,13H,2-3,7-9H2,1H3,(H,19,22)(H,20,21)/t10-,13+/m1/s1 |
| InChIKey | UGLKPGSRXDMUCR-MFKMUULPSA-N |
| XLogP | 1.23 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |