C20H24FNO4 — CID 95048509
[2-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl] 2-cyclohexylideneacetate (PubChem CID 95048509) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is [2-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl] 2-cyclohexylideneacetate.
| Compound Name | [2-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl] 2-cyclohexylideneacetate |
|---|---|
| PubChem CID | 95048509 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [2-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl] 2-cyclohexylideneacetate |
| SMILES | O=C(C=C1CCCCC1)OCC(=O)N1CCO[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H24FNO4/c21-17-8-6-16(7-9-17)18-13-22(10-11-25-18)19(23)14-26-20(24)12-15-4-2-1-3-5-15/h6-9,12,18H,1-5,10-11,13-14H2/t18-/m1/s1 |
| InChIKey | XLMLAXAEZRFSHA-GOSISDBHSA-N |
| XLogP | 3.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|