C21H28N4O2S — CID 95059646
(2R)-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)-N-(3-propylsulfanylpropyl)butanamide (PubChem CID 95059646) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is (2R)-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)-N-(3-propylsulfanylpropyl)butanamide.
| Compound Name | (2R)-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)-N-(3-propylsulfanylpropyl)butanamide |
|---|---|
| PubChem CID | 95059646 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (2R)-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)-N-(3-propylsulfanylpropyl)butanamide |
| SMILES | CCCSCCCNC(=O)[C@@H](CC)n1c2ccccc2c2cnn(C)c(=O)c21 |
| InChI | InChI=1S/C21H28N4O2S/c1-4-12-28-13-8-11-22-20(26)17(5-2)25-18-10-7-6-9-15(18)16-14-23-24(3)21(27)19(16)25/h6-7,9-10,14,17H,4-5,8,11-13H2,1-3H3,(H,22,26)/t17-/m1/s1 |
| InChIKey | VGLPLRJDRYIYFD-QGZVFWFLSA-N |
| XLogP | 3.49 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|