C23H30N4O2 — CID 95064515
(2R)-N-cyclooctyl-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)butanamide (PubChem CID 95064515) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (2R)-N-cyclooctyl-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)butanamide.
| Compound Name | (2R)-N-cyclooctyl-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)butanamide |
|---|---|
| PubChem CID | 95064515 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (2R)-N-cyclooctyl-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)butanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCCCC1)n1c2ccccc2c2cnn(C)c(=O)c21 |
| InChI | InChI=1S/C23H30N4O2/c1-3-19(22(28)25-16-11-7-5-4-6-8-12-16)27-20-14-10-9-13-17(20)18-15-24-26(2)23(29)21(18)27/h9-10,13-16,19H,3-8,11-12H2,1-2H3,(H,25,28)/t19-/m1/s1 |
| InChIKey | SGTUXZCAFFVGEE-LJQANCHMSA-N |
| XLogP | 4.07 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |