About 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide
3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 95063974) has the molecular formula C13H15BrN2O2S
and a molecular weight of 343.25 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 95063974 |
| Molecular Formula | C13H15BrN2O2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CC[C@H](C)NC(=O)c1c(-c2ccc(Br)s2)noc1C |
| InChI | InChI=1S/C13H15BrN2O2S/c1-4-7(2)15-13(17)11-8(3)18-16-12(11)9-5-6-10(14)19-9/h5-7H,4H2,1-3H3,(H,15,17)/t7-/m0/s1 |
| InChIKey | AXLHAFFPDIXHOL-ZETCQYMHSA-N |
| XLogP | 4.00 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide (CID 95063974) is 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide is CC[C@H](C)NC(=O)c1c(-c2ccc(Br)s2)noc1C.
What is the InChIKey of 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is AXLHAFFPDIXHOL-ZETCQYMHSA-N. The full InChI is InChI=1S/C13H15BrN2O2S/c1-4-7(2)15-13(17)11-8(3)18-16-12(11)9-5-6-10(14)19-9/h5-7H,4H2,1-3H3,(H,15,17)/t7-/m0/s1.
What are the key properties of 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide?
3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 343.25 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromothiophen-2-yl)-N-[(2S)-butan-2-yl]-5-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 95063974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).