C24H29N5O3 — CID 95064262
11-benzyl-2-ethyl-8-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide (PubChem CID 95064262) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 11-benzyl-2-ethyl-8-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide.
| Compound Name | 11-benzyl-2-ethyl-8-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 95064262 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 11-benzyl-2-ethyl-8-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
| SMILES | CCn1c2c(c(=O)n3ncc(C(=O)NC[C@H]4CCCO4)c13)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C24H29N5O3/c1-2-28-21-10-11-27(15-17-7-4-3-5-8-17)16-20(21)24(31)29-23(28)19(14-26-29)22(30)25-13-18-9-6-12-32-18/h3-5,7-8,14,18H,2,6,9-13,15-16H2,1H3,(H,25,30)/t18-/m1/s1 |
| InChIKey | LBADFSSVVKVLDJ-GOSISDBHSA-N |
| XLogP | 1.98 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |