C24H32N6O2 — CID 53053673
11-benzyl-N-[2-(diethylamino)ethyl]-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide (PubChem CID 53053673) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 11-benzyl-N-[2-(diethylamino)ethyl]-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide.
| Compound Name | 11-benzyl-N-[2-(diethylamino)ethyl]-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 53053673 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 11-benzyl-N-[2-(diethylamino)ethyl]-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cnn2c(=O)c3c(n(C)c12)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C24H32N6O2/c1-4-28(5-2)14-12-25-22(31)19-15-26-30-23(19)27(3)21-11-13-29(17-20(21)24(30)32)16-18-9-7-6-8-10-18/h6-10,15H,4-5,11-14,16-17H2,1-3H3,(H,25,31) |
| InChIKey | VBOAFJXVIWIFFB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |