C25H25N5O3 — CID 53053652
11-benzyl-N-(3-methoxyphenyl)-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide (PubChem CID 53053652) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 11-benzyl-N-(3-methoxyphenyl)-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide.
| Compound Name | 11-benzyl-N-(3-methoxyphenyl)-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 53053652 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 11-benzyl-N-(3-methoxyphenyl)-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cnn3c(=O)c4c(n(C)c23)CCN(Cc2ccccc2)C4)c1 |
| InChI | InChI=1S/C25H25N5O3/c1-28-22-11-12-29(15-17-7-4-3-5-8-17)16-21(22)25(32)30-24(28)20(14-26-30)23(31)27-18-9-6-10-19(13-18)33-2/h3-10,13-14H,11-12,15-16H2,1-2H3,(H,27,31) |
| InChIKey | CMUOHNSZPWFTMV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |