C27H27N5O5 — CID 53210488
N-(1,3-benzodioxol-5-yl)-2-ethyl-11-[(4-methoxyphenyl)methyl]-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide (PubChem CID 53210488) has the molecular formula C27H27N5O5 and a molecular weight of 501.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-ethyl-11-[(4-methoxyphenyl)methyl]-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-ethyl-11-[(4-methoxyphenyl)methyl]-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 53210488 |
| Molecular Formula | C27H27N5O5 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-ethyl-11-[(4-methoxyphenyl)methyl]-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
| SMILES | CCn1c2c(c(=O)n3ncc(C(=O)Nc4ccc5c(c4)OCO5)c13)CN(Cc1ccc(OC)cc1)CC2 |
| InChI | InChI=1S/C27H27N5O5/c1-3-31-22-10-11-30(14-17-4-7-19(35-2)8-5-17)15-21(22)27(34)32-26(31)20(13-28-32)25(33)29-18-6-9-23-24(12-18)37-16-36-23/h4-9,12-13H,3,10-11,14-16H2,1-2H3,(H,29,33) |
| InChIKey | APYMNIPZDFRPHR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |