C25H24ClN5O2 — CID 53053709
11-benzyl-N-[(3-chlorophenyl)methyl]-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide (PubChem CID 53053709) has the molecular formula C25H24ClN5O2 and a molecular weight of 461.95 g/mol. Its IUPAC name is 11-benzyl-N-[(3-chlorophenyl)methyl]-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide.
| Compound Name | 11-benzyl-N-[(3-chlorophenyl)methyl]-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 53053709 |
| Molecular Formula | C25H24ClN5O2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 11-benzyl-N-[(3-chlorophenyl)methyl]-2-methyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
| SMILES | Cn1c2c(c(=O)n3ncc(C(=O)NCc4cccc(Cl)c4)c13)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C25H24ClN5O2/c1-29-22-10-11-30(15-17-6-3-2-4-7-17)16-21(22)25(33)31-24(29)20(14-28-31)23(32)27-13-18-8-5-9-19(26)12-18/h2-9,12,14H,10-11,13,15-16H2,1H3,(H,27,32) |
| InChIKey | PLRWUKGZTGYISW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |