C21H23F2N3O2 — CID 95065481
4-[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-N-(4-fluorophenyl)piperidine-1-carboxamide (PubChem CID 95065481) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 4-[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-N-(4-fluorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-N-(4-fluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95065481 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-N-(4-fluorophenyl)piperidine-1-carboxamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1F)C1CCN(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-14(20(27)25-19-5-3-2-4-18(19)23)15-10-12-26(13-11-15)21(28)24-17-8-6-16(22)7-9-17/h2-9,14-15H,10-13H2,1H3,(H,24,28)(H,25,27)/t14-/m0/s1 |
| InChIKey | AHAABBAYNRUCDA-AWEZNQCLSA-N |
| XLogP | 4.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |