C21H24ClN3O2 — CID 95065297
4-[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl]-N-phenylpiperidine-1-carboxamide (PubChem CID 95065297) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 4-[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 95065297 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl]-N-phenylpiperidine-1-carboxamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1Cl)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-15(20(26)24-19-10-6-5-9-18(19)22)16-11-13-25(14-12-16)21(27)23-17-7-3-2-4-8-17/h2-10,15-16H,11-14H2,1H3,(H,23,27)(H,24,26)/t15-/m0/s1 |
| InChIKey | BYBBTXPQLJOCPZ-HNNXBMFYSA-N |
| XLogP | 4.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |