C21H23N3O5S — CID 95067269
(2S)-7-(4-benzoylpiperazin-1-yl)sulfonyl-2,6-dimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 95067269) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is (2S)-7-(4-benzoylpiperazin-1-yl)sulfonyl-2,6-dimethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-7-(4-benzoylpiperazin-1-yl)sulfonyl-2,6-dimethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 95067269 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (2S)-7-(4-benzoylpiperazin-1-yl)sulfonyl-2,6-dimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc2c(cc1S(=O)(=O)N1CCN(C(=O)c3ccccc3)CC1)O[C@@H](C)C(=O)N2 |
| InChI | InChI=1S/C21H23N3O5S/c1-14-12-17-18(29-15(2)20(25)22-17)13-19(14)30(27,28)24-10-8-23(9-11-24)21(26)16-6-4-3-5-7-16/h3-7,12-13,15H,8-11H2,1-2H3,(H,22,25)/t15-/m0/s1 |
| InChIKey | ZXUXSHJOILRCQC-HNNXBMFYSA-N |
| XLogP | 1.86 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |