C24H23N3O7S — CID 92501814
(2R)-2,6-dimethyl-7-[4-(2-oxochromene-3-carbonyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 92501814) has the molecular formula C24H23N3O7S and a molecular weight of 497.53 g/mol. Its IUPAC name is (2R)-2,6-dimethyl-7-[4-(2-oxochromene-3-carbonyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | (2R)-2,6-dimethyl-7-[4-(2-oxochromene-3-carbonyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 92501814 |
| Molecular Formula | C24H23N3O7S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (2R)-2,6-dimethyl-7-[4-(2-oxochromene-3-carbonyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc2c(cc1S(=O)(=O)N1CCN(C(=O)c3cc4ccccc4oc3=O)CC1)O[C@H](C)C(=O)N2 |
| InChI | InChI=1S/C24H23N3O7S/c1-14-11-18-20(33-15(2)22(28)25-18)13-21(14)35(31,32)27-9-7-26(8-10-27)23(29)17-12-16-5-3-4-6-19(16)34-24(17)30/h3-6,11-13,15H,7-10H2,1-2H3,(H,25,28)/t15-/m1/s1 |
| InChIKey | YTHVEVCQNHWJRB-OAHLLOKOSA-N |
| XLogP | 1.97 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|