C20H22N4O5S — CID 53078770
3-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazine-1-carbonyl]chromen-2-one (PubChem CID 53078770) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is 3-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 53078770 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazine-1-carbonyl]chromen-2-one |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCN(C(=O)c2cc3ccccc3oc2=O)CC1 |
| InChI | InChI=1S/C20H22N4O5S/c1-13-18(14(2)22(3)21-13)30(27,28)24-10-8-23(9-11-24)19(25)16-12-15-6-4-5-7-17(15)29-20(16)26/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | FEWPTLATJNQIFN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|