C22H20N2O4 — CID 95073950
(7S)-N-(2,5-dimethylphenyl)-7-(furan-2-yl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 95073950) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (7S)-N-(2,5-dimethylphenyl)-7-(furan-2-yl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (7S)-N-(2,5-dimethylphenyl)-7-(furan-2-yl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 95073950 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (7S)-N-(2,5-dimethylphenyl)-7-(furan-2-yl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2cc3c([nH]c2=O)C[C@H](c2ccco2)CC3=O)c1 |
| InChI | InChI=1S/C22H20N2O4/c1-12-5-6-13(2)17(8-12)23-21(26)16-11-15-18(24-22(16)27)9-14(10-19(15)25)20-4-3-7-28-20/h3-8,11,14H,9-10H2,1-2H3,(H,23,26)(H,24,27)/t14-/m0/s1 |
| InChIKey | FPABUOOOHVIWRT-AWEZNQCLSA-N |
| XLogP | 3.75 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |