C26H26N2O5 — CID 95073913
(7S)-7-(3,4-dimethoxyphenyl)-N-(2,6-dimethylphenyl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 95073913) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is (7S)-7-(3,4-dimethoxyphenyl)-N-(2,6-dimethylphenyl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (7S)-7-(3,4-dimethoxyphenyl)-N-(2,6-dimethylphenyl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 95073913 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (7S)-7-(3,4-dimethoxyphenyl)-N-(2,6-dimethylphenyl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1ccc([C@@H]2CC(=O)c3cc(C(=O)Nc4c(C)cccc4C)c(=O)[nH]c3C2)cc1OC |
| InChI | InChI=1S/C26H26N2O5/c1-14-6-5-7-15(2)24(14)28-26(31)19-13-18-20(27-25(19)30)10-17(11-21(18)29)16-8-9-22(32-3)23(12-16)33-4/h5-9,12-13,17H,10-11H2,1-4H3,(H,27,30)(H,28,31)/t17-/m0/s1 |
| InChIKey | KUTYUVVFUWXDGH-KRWDZBQOSA-N |
| XLogP | 4.17 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |