C19H19NO7 — CID 42582251
(7R)-2,5-dioxo-7-(3,4,5-trimethoxyphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxylic acid (PubChem CID 42582251) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is (7R)-2,5-dioxo-7-(3,4,5-trimethoxyphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxylic acid.
| Compound Name | (7R)-2,5-dioxo-7-(3,4,5-trimethoxyphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 42582251 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (7R)-2,5-dioxo-7-(3,4,5-trimethoxyphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxylic acid |
| SMILES | COc1cc([C@H]2CC(=O)c3cc(C(=O)O)c(=O)[nH]c3C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO7/c1-25-15-6-10(7-16(26-2)17(15)27-3)9-4-13-11(14(21)5-9)8-12(19(23)24)18(22)20-13/h6-9H,4-5H2,1-3H3,(H,20,22)(H,23,24)/t9-/m1/s1 |
| InChIKey | CMKSIMVJKNDLRP-SECBINFHSA-N |
| XLogP | 2.01 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |