C16H22N2O5S2 — CID 95090012
(3S)-N-(2-methoxyethyl)-3-[(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-7-yl)sulfonyl]butanamide (PubChem CID 95090012) has the molecular formula C16H22N2O5S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (3S)-N-(2-methoxyethyl)-3-[(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-7-yl)sulfonyl]butanamide.
| Compound Name | (3S)-N-(2-methoxyethyl)-3-[(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-7-yl)sulfonyl]butanamide |
|---|---|
| PubChem CID | 95090012 |
| Molecular Formula | C16H22N2O5S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (3S)-N-(2-methoxyethyl)-3-[(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-7-yl)sulfonyl]butanamide |
| SMILES | COCCNC(=O)C[C@H](C)S(=O)(=O)c1ccc2c(c1)NC(=O)CCS2 |
| InChI | InChI=1S/C16H22N2O5S2/c1-11(9-16(20)17-6-7-23-2)25(21,22)12-3-4-14-13(10-12)18-15(19)5-8-24-14/h3-4,10-11H,5-9H2,1-2H3,(H,17,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | FMQAQXGQRCHOIV-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|