C21H30FN3O2 — CID 95094005
(3R)-3-[3-(cyclohexylamino)-3-oxopropyl]-N-(3-fluorophenyl)piperidine-1-carboxamide (PubChem CID 95094005) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is (3R)-3-[3-(cyclohexylamino)-3-oxopropyl]-N-(3-fluorophenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-[3-(cyclohexylamino)-3-oxopropyl]-N-(3-fluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95094005 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (3R)-3-[3-(cyclohexylamino)-3-oxopropyl]-N-(3-fluorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(CC[C@H]1CCCN(C(=O)Nc2cccc(F)c2)C1)NC1CCCCC1 |
| InChI | InChI=1S/C21H30FN3O2/c22-17-7-4-10-19(14-17)24-21(27)25-13-5-6-16(15-25)11-12-20(26)23-18-8-2-1-3-9-18/h4,7,10,14,16,18H,1-3,5-6,8-9,11-13,15H2,(H,23,26)(H,24,27)/t16-/m1/s1 |
| InChIKey | OZHFIIJOJICKLW-MRXNPFEDSA-N |
| XLogP | 4.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |