C15H21N3O3S — CID 95096849
2-[(3R)-1-ethyl-2-oxopyrido[2,3-b][1,4]thiazin-3-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 95096849) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[(3R)-1-ethyl-2-oxopyrido[2,3-b][1,4]thiazin-3-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(3R)-1-ethyl-2-oxopyrido[2,3-b][1,4]thiazin-3-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 95096849 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[(3R)-1-ethyl-2-oxopyrido[2,3-b][1,4]thiazin-3-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | CCN1C(=O)[C@@H](CC(=O)NCCCOC)Sc2ncccc21 |
| InChI | InChI=1S/C15H21N3O3S/c1-3-18-11-6-4-7-17-14(11)22-12(15(18)20)10-13(19)16-8-5-9-21-2/h4,6-7,12H,3,5,8-10H2,1-2H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | NPTABRLCOQLYFB-GFCCVEGCSA-N |
| XLogP | 1.45 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|