C16H23N3O2S — CID 95096981
2-[(3R)-1-butyl-2-oxopyrido[2,3-b][1,4]thiazin-3-yl]-N-propylacetamide (PubChem CID 95096981) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 2-[(3R)-1-butyl-2-oxopyrido[2,3-b][1,4]thiazin-3-yl]-N-propylacetamide.
| Compound Name | 2-[(3R)-1-butyl-2-oxopyrido[2,3-b][1,4]thiazin-3-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 95096981 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[(3R)-1-butyl-2-oxopyrido[2,3-b][1,4]thiazin-3-yl]-N-propylacetamide |
| SMILES | CCCCN1C(=O)[C@@H](CC(=O)NCCC)Sc2ncccc21 |
| InChI | InChI=1S/C16H23N3O2S/c1-3-5-10-19-12-7-6-9-18-15(12)22-13(16(19)21)11-14(20)17-8-4-2/h6-7,9,13H,3-5,8,10-11H2,1-2H3,(H,17,20)/t13-/m1/s1 |
| InChIKey | DWJUTDOHZRBWGK-CYBMUJFWSA-N |
| XLogP | 2.61 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |